C19H17Cl2N5O3S — CID 17413118
4-[(3,4-dichlorophenyl)sulfonylamino]-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)benzamide (PubChem CID 17413118) has the molecular formula C19H17Cl2N5O3S and a molecular weight of 466.35 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)sulfonylamino]-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)benzamide.
| Compound Name | 4-[(3,4-dichlorophenyl)sulfonylamino]-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17413118 |
| Molecular Formula | C19H17Cl2N5O3S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)sulfonylamino]-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1nnc2n1CCC2)c1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H17Cl2N5O3S/c20-15-8-7-14(10-16(15)21)30(28,29)25-13-5-3-12(4-6-13)19(27)22-11-18-24-23-17-2-1-9-26(17)18/h3-8,10,25H,1-2,9,11H2,(H,22,27) |
| InChIKey | KDGTUFMLFRHWFN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |