C17H16Cl2N2O5S2 — CID 27710577
4-[(3,4-dichlorophenyl)sulfonylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 27710577) has the molecular formula C17H16Cl2N2O5S2 and a molecular weight of 463.36 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)sulfonylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 4-[(3,4-dichlorophenyl)sulfonylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 27710577 |
| Molecular Formula | C17H16Cl2N2O5S2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)sulfonylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)c1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O5S2/c18-15-6-5-14(9-16(15)19)28(25,26)21-12-3-1-11(2-4-12)17(22)20-13-7-8-27(23,24)10-13/h1-6,9,13,21H,7-8,10H2,(H,20,22)/t13-/m1/s1 |
| InChIKey | AZDUHTWRIHCHCL-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |