C20H27N5O3S — CID 51730663
N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide (PubChem CID 51730663) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 51730663 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzamide |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2cccc(C(=O)NCc3nnc4n3CCC4)c2)C1 |
| InChI | InChI=1S/C20H27N5O3S/c1-14-9-15(2)13-24(12-14)29(27,28)17-6-3-5-16(10-17)20(26)21-11-19-23-22-18-7-4-8-25(18)19/h3,5-6,10,14-15H,4,7-9,11-13H2,1-2H3,(H,21,26)/t14-,15-/m0/s1 |
| InChIKey | REFKZVCUHCBWHK-GJZGRUSLSA-N |
| XLogP | 1.82 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |