C28H31N5O3 — CID 18318137
5-[[3-(3-carbamimidoylphenyl)phenyl]methylamino]-2-(1-ethanimidoylpiperidin-4-yl)oxybenzoic acid (PubChem CID 18318137) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 5-[[3-(3-carbamimidoylphenyl)phenyl]methylamino]-2-(1-ethanimidoylpiperidin-4-yl)oxybenzoic acid.
| Compound Name | 5-[[3-(3-carbamimidoylphenyl)phenyl]methylamino]-2-(1-ethanimidoylpiperidin-4-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 18318137 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 5-[[3-(3-carbamimidoylphenyl)phenyl]methylamino]-2-(1-ethanimidoylpiperidin-4-yl)oxybenzoic acid |
| SMILES | [H]/N=C(\N)c1cccc(-c2cccc(CNc3ccc(OC4CCN(/C(C)=N/[H])CC4)c(C(=O)O)c3)c2)c1 |
| InChI | InChI=1S/C28H31N5O3/c1-18(29)33-12-10-24(11-13-33)36-26-9-8-23(16-25(26)28(34)35)32-17-19-4-2-5-20(14-19)21-6-3-7-22(15-21)27(30)31/h2-9,14-16,24,29,32H,10-13,17H2,1H3,(H3,30,31)(H,34,35)/b29-18+ |
| InChIKey | PXJCSQDZWKYSNT-RDRPBHBLSA-N |
| XLogP | 4.79 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|