C22H26N4O3 — CID 70167650
5-[3-(3-carbamimidoylphenyl)prop-2-enylamino]-2-piperidin-4-yloxybenzoic acid (PubChem CID 70167650) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-[3-(3-carbamimidoylphenyl)prop-2-enylamino]-2-piperidin-4-yloxybenzoic acid.
| Compound Name | 5-[3-(3-carbamimidoylphenyl)prop-2-enylamino]-2-piperidin-4-yloxybenzoic acid |
|---|---|
| PubChem CID | 70167650 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 5-[3-(3-carbamimidoylphenyl)prop-2-enylamino]-2-piperidin-4-yloxybenzoic acid |
| SMILES | [H]/N=C(\N)c1cccc(C=CCNc2ccc(OC3CCNCC3)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C22H26N4O3/c23-21(24)16-5-1-3-15(13-16)4-2-10-26-17-6-7-20(19(14-17)22(27)28)29-18-8-11-25-12-9-18/h1-7,13-14,18,25-26H,8-12H2,(H3,23,24)(H,27,28) |
| InChIKey | BVUJKTJVKIQFPY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|