C26H32ClN5O6S — CID 73450136
ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-(3-carbamoyl-5-chloro-4-piperidin-4-yloxyphenyl)sulfamoyl]acetate (PubChem CID 73450136) has the molecular formula C26H32ClN5O6S and a molecular weight of 578.09 g/mol. Its IUPAC name is ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-(3-carbamoyl-5-chloro-4-piperidin-4-yloxyphenyl)sulfamoyl]acetate.
| Compound Name | ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-(3-carbamoyl-5-chloro-4-piperidin-4-yloxyphenyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 73450136 |
| Molecular Formula | C26H32ClN5O6S |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-(3-carbamoyl-5-chloro-4-piperidin-4-yloxyphenyl)sulfamoyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(C=CCN(c2cc(Cl)c(OC3CCNCC3)c(C(N)=O)c2)S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C26H32ClN5O6S/c1-2-37-23(33)16-39(35,36)32(12-4-6-17-5-3-7-18(13-17)25(28)29)19-14-21(26(30)34)24(22(27)15-19)38-20-8-10-31-11-9-20/h3-7,13-15,20,31H,2,8-12,16H2,1H3,(H3,28,29)(H2,30,34) |
| InChIKey | VVBRHQCSIXHAFI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|