C27H34ClN5O5S — CID 73450007
ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-[3-chloro-4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate (PubChem CID 73450007) has the molecular formula C27H34ClN5O5S and a molecular weight of 576.12 g/mol. Its IUPAC name is ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-[3-chloro-4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate.
| Compound Name | ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-[3-chloro-4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 73450007 |
| Molecular Formula | C27H34ClN5O5S |
| Molecular Weight | 576.12 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | ethyl 2-[3-(3-carbamimidoylphenyl)prop-2-enyl-[3-chloro-4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(C=CCN(c2ccc(OC3CCN(/C(C)=N/[H])CC3)c(Cl)c2)S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C27H34ClN5O5S/c1-3-37-26(34)18-39(35,36)33(13-5-7-20-6-4-8-21(16-20)27(30)31)22-9-10-25(24(28)17-22)38-23-11-14-32(15-12-23)19(2)29/h4-10,16-17,23,29H,3,11-15,18H2,1-2H3,(H3,30,31)/b7-5?,29-19+ |
| InChIKey | JUYIWQRXHDCGJO-CRAREDPHSA-N |
| XLogP | 3.88 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|