C27H35ClN4O5S — CID 25179078
2-[[4-(1-butylpiperidin-4-yl)oxy-3-chlorophenyl]-[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]sulfamoyl]acetic acid (PubChem CID 25179078) has the molecular formula C27H35ClN4O5S and a molecular weight of 563.12 g/mol. Its IUPAC name is 2-[[4-(1-butylpiperidin-4-yl)oxy-3-chlorophenyl]-[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]sulfamoyl]acetic acid.
| Compound Name | 2-[[4-(1-butylpiperidin-4-yl)oxy-3-chlorophenyl]-[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 25179078 |
| Molecular Formula | C27H35ClN4O5S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 2-[[4-(1-butylpiperidin-4-yl)oxy-3-chlorophenyl]-[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]sulfamoyl]acetic acid |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/CN(c2ccc(OC3CCN(CCCC)CC3)c(Cl)c2)S(=O)(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C27H35ClN4O5S/c1-2-3-13-31-15-11-23(12-16-31)37-25-10-9-22(18-24(25)28)32(38(35,36)19-26(33)34)14-5-7-20-6-4-8-21(17-20)27(29)30/h4-10,17-18,23H,2-3,11-16,19H2,1H3,(H3,29,30)(H,33,34)/b7-5+ |
| InChIKey | NXVZJXSHZDLLQU-FNORWQNLSA-N |
| XLogP | 4.20 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|