C30H34ClN5O5S — CID 22181224
ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1-pyridin-2-ylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate (PubChem CID 22181224) has the molecular formula C30H34ClN5O5S and a molecular weight of 612.15 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1-pyridin-2-ylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate.
| Compound Name | ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1-pyridin-2-ylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 22181224 |
| Molecular Formula | C30H34ClN5O5S |
| Molecular Weight | 612.15 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1-pyridin-2-ylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/CN(c2ccc(OC3CCN(c4ccccn4)CC3)c(Cl)c2)S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C30H34ClN5O5S/c1-2-40-29(37)21-42(38,39)36(16-6-8-22-7-5-9-23(19-22)30(32)33)24-11-12-27(26(31)20-24)41-25-13-17-35(18-14-25)28-10-3-4-15-34-28/h3-12,15,19-20,25H,2,13-14,16-18,21H2,1H3,(H3,32,33)/b8-6+ |
| InChIKey | FOPQQCAKPHNTHN-SOFGYWHQSA-N |
| XLogP | 4.48 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|