C26H27F3N4O — CID 18318152
3-[3-[[4-piperidin-4-yloxy-3-(trifluoromethyl)anilino]methyl]phenyl]benzenecarboximidamide (PubChem CID 18318152) has the molecular formula C26H27F3N4O and a molecular weight of 468.52 g/mol. Its IUPAC name is 3-[3-[[4-piperidin-4-yloxy-3-(trifluoromethyl)anilino]methyl]phenyl]benzenecarboximidamide.
| Compound Name | 3-[3-[[4-piperidin-4-yloxy-3-(trifluoromethyl)anilino]methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18318152 |
| Molecular Formula | C26H27F3N4O |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 3-[3-[[4-piperidin-4-yloxy-3-(trifluoromethyl)anilino]methyl]phenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2cccc(CNc3ccc(OC4CCNCC4)c(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C26H27F3N4O/c27-26(28,29)23-15-21(7-8-24(23)34-22-9-11-32-12-10-22)33-16-17-3-1-4-18(13-17)19-5-2-6-20(14-19)25(30)31/h1-8,13-15,22,32-33H,9-12,16H2,(H3,30,31) |
| InChIKey | OZKRKCGCMMORQI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|