C21H26N4 — CID 160594463
4-benzylpiperidine;1H-indole-5-carboximidamide (PubChem CID 160594463) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 4-benzylpiperidine;1H-indole-5-carboximidamide.
| Compound Name | 4-benzylpiperidine;1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 160594463 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 4-benzylpiperidine;1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]ccc2c1.c1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C12H17N.C9H9N3/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12;10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5,12-13H,6-10H2;1-5,12H,(H3,10,11) |
| InChIKey | RDLHTSAVARHGGJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|