About 4-benzylpiperidine;1H-indole-5-carboximidamide
4-benzylpiperidine;1H-indole-5-carboximidamide (PubChem CID 160594463) has the molecular formula C21H26N4
and a molecular weight of 334.47 g/mol. Its IUPAC name is 4-benzylpiperidine;1H-indole-5-carboximidamide.
Molecular Properties
| Compound Name | 4-benzylpiperidine;1H-indole-5-carboximidamide |
| PubChem CID | 160594463 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 4-benzylpiperidine;1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]ccc2c1.c1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C12H17N.C9H9N3/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12;10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5,12-13H,6-10H2;1-5,12H,(H3,10,11) |
| InChIKey | RDLHTSAVARHGGJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylpiperidine;1H-indole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylpiperidine;1H-indole-5-carboximidamide?
The IUPAC name of 4-benzylpiperidine;1H-indole-5-carboximidamide (CID 160594463) is 4-benzylpiperidine;1H-indole-5-carboximidamide.
What is the SMILES notation for 4-benzylpiperidine;1H-indole-5-carboximidamide?
The canonical SMILES for 4-benzylpiperidine;1H-indole-5-carboximidamide is [H]/N=C(\N)c1ccc2[nH]ccc2c1.c1ccc(CC2CCNCC2)cc1.
What is the InChIKey of 4-benzylpiperidine;1H-indole-5-carboximidamide?
The InChIKey is RDLHTSAVARHGGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.C9H9N3/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12;10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5,12-13H,6-10H2;1-5,12H,(H3,10,11).
What are the key properties of 4-benzylpiperidine;1H-indole-5-carboximidamide?
4-benzylpiperidine;1H-indole-5-carboximidamide has a molecular weight of 334.47 g/mol, XLogP of 3.68, 3 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylpiperidine;1H-indole-5-carboximidamide is sourced from PubChem (CID 160594463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).