C20H20N2O — CID 59744730
[(2R)-2-benzylpyrrolidin-2-yl]-(1H-indol-5-yl)methanone (PubChem CID 59744730) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is [(2R)-2-benzylpyrrolidin-2-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(2R)-2-benzylpyrrolidin-2-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 59744730 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [(2R)-2-benzylpyrrolidin-2-yl]-(1H-indol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ccc2c1)[C@]1(Cc2ccccc2)CCCN1 |
| InChI | InChI=1S/C20H20N2O/c23-19(17-7-8-18-16(13-17)9-12-21-18)20(10-4-11-22-20)14-15-5-2-1-3-6-15/h1-3,5-9,12-13,21-22H,4,10-11,14H2/t20-/m1/s1 |
| InChIKey | LPLLJFFJYKVRLO-HXUWFJFHSA-N |
| XLogP | 3.72 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |