C23H31N5 — CID 22983146
3-[3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-methylphenyl]benzenecarboximidamide (PubChem CID 22983146) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is 3-[3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-methylphenyl]benzenecarboximidamide.
| Compound Name | 3-[3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-methylphenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22983146 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 3-[3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-methylphenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2cc(C)cc(CNCC3CCN(/C(C)=N/[H])CC3)c2)c1 |
| InChI | InChI=1S/C23H31N5/c1-16-10-19(15-27-14-18-6-8-28(9-7-18)17(2)24)12-22(11-16)20-4-3-5-21(13-20)23(25)26/h3-5,10-13,18,24,27H,6-9,14-15H2,1-2H3,(H3,25,26)/b24-17+ |
| InChIKey | WDHYRAGVBGDKKO-JJIBRWJFSA-N |
| XLogP | 3.74 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|