C23H29N5O2 — CID 91186735
3-(4-carbamimidoylphenyl)-5-[[[1-(2-iminoethyl)piperidin-4-yl]methylamino]methyl]benzoic acid (PubChem CID 91186735) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-(4-carbamimidoylphenyl)-5-[[[1-(2-iminoethyl)piperidin-4-yl]methylamino]methyl]benzoic acid.
| Compound Name | 3-(4-carbamimidoylphenyl)-5-[[[1-(2-iminoethyl)piperidin-4-yl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 91186735 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-(4-carbamimidoylphenyl)-5-[[[1-(2-iminoethyl)piperidin-4-yl]methylamino]methyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(CNCC3CCN(C/C=N/[H])CC3)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C23H29N5O2/c24-7-10-28-8-5-16(6-9-28)14-27-15-17-11-20(13-21(12-17)23(29)30)18-1-3-19(4-2-18)22(25)26/h1-4,7,11-13,16,24,27H,5-6,8-10,14-15H2,(H3,25,26)(H,29,30)/b24-7+ |
| InChIKey | AHABOLXACOWQTB-HCBMXOAHSA-N |
| XLogP | 2.79 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|