C23H28N4O2 — CID 142027924
3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-(3-methanimidoylphenyl)benzoic acid (PubChem CID 142027924) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-(3-methanimidoylphenyl)benzoic acid.
| Compound Name | 3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-(3-methanimidoylphenyl)benzoic acid |
|---|---|
| PubChem CID | 142027924 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-[[(1-ethanimidoylpiperidin-4-yl)methylamino]methyl]-5-(3-methanimidoylphenyl)benzoic acid |
| SMILES | [H]/N=C/c1cccc(-c2cc(CNCC3CCN(/C(C)=N/[H])CC3)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-16(25)27-7-5-17(6-8-27)14-26-15-19-10-21(12-22(11-19)23(28)29)20-4-2-3-18(9-20)13-24/h2-4,9-13,17,24-26H,5-8,14-15H2,1H3,(H,28,29)/b24-13+,25-16+ |
| InChIKey | QSDFBFJFVSMKNI-SMQVFWRZSA-N |
| XLogP | 3.85 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|