C23H25N5O4 — CID 142651650
3-(3-carbamimidoylphenyl)-5-[[[1-(2,3-dioxoaziridin-1-yl)piperidin-4-yl]methylamino]methyl]benzoic acid (PubChem CID 142651650) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-5-[[[1-(2,3-dioxoaziridin-1-yl)piperidin-4-yl]methylamino]methyl]benzoic acid.
| Compound Name | 3-(3-carbamimidoylphenyl)-5-[[[1-(2,3-dioxoaziridin-1-yl)piperidin-4-yl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 142651650 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-5-[[[1-(2,3-dioxoaziridin-1-yl)piperidin-4-yl]methylamino]methyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1cccc(-c2cc(CNCC3CCN(n4c(=O)c4=O)CC3)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H25N5O4/c24-20(25)17-3-1-2-16(10-17)18-8-15(9-19(11-18)23(31)32)13-26-12-14-4-6-27(7-5-14)28-21(29)22(28)30/h1-3,8-11,14,26H,4-7,12-13H2,(H3,24,25)(H,31,32) |
| InChIKey | LQANUSDTWHDDII-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|