C24H33N5O — CID 22716866
N-[[4-(aminomethyl)-4-phenylcyclohexyl]methyl]-2-[(3-carbamimidoylphenyl)methylamino]acetamide (PubChem CID 22716866) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[[4-(aminomethyl)-4-phenylcyclohexyl]methyl]-2-[(3-carbamimidoylphenyl)methylamino]acetamide.
| Compound Name | N-[[4-(aminomethyl)-4-phenylcyclohexyl]methyl]-2-[(3-carbamimidoylphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 22716866 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N-[[4-(aminomethyl)-4-phenylcyclohexyl]methyl]-2-[(3-carbamimidoylphenyl)methylamino]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(CNCC(=O)NCC2CCC(CN)(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H33N5O/c25-17-24(21-7-2-1-3-8-21)11-9-18(10-12-24)15-29-22(30)16-28-14-19-5-4-6-20(13-19)23(26)27/h1-8,13,18,28H,9-12,14-17,25H2,(H3,26,27)(H,29,30) |
| InChIKey | MZJKQAPPRDRQEF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|