C27H35N5O3 — CID 20637142
3-[[butanoyl-[(1-ethanimidoylpiperidin-4-yl)methyl]amino]methyl]-5-(3-carbamimidoylphenyl)benzoic acid (PubChem CID 20637142) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 3-[[butanoyl-[(1-ethanimidoylpiperidin-4-yl)methyl]amino]methyl]-5-(3-carbamimidoylphenyl)benzoic acid.
| Compound Name | 3-[[butanoyl-[(1-ethanimidoylpiperidin-4-yl)methyl]amino]methyl]-5-(3-carbamimidoylphenyl)benzoic acid |
|---|---|
| PubChem CID | 20637142 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 3-[[butanoyl-[(1-ethanimidoylpiperidin-4-yl)methyl]amino]methyl]-5-(3-carbamimidoylphenyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1cccc(-c2cc(CN(CC3CCN(/C(C)=N/[H])CC3)C(=O)CCC)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C27H35N5O3/c1-3-5-25(33)32(16-19-8-10-31(11-9-19)18(2)28)17-20-12-23(15-24(13-20)27(34)35)21-6-4-7-22(14-21)26(29)30/h4,6-7,12-15,19,28H,3,5,8-11,16-17H2,1-2H3,(H3,29,30)(H,34,35)/b28-18+ |
| InChIKey | WZSYHIKUGXSHLP-MTDXEUNCSA-N |
| XLogP | 4.17 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|