C24H27N3O3 — CID 139798605
methyl 3-(3-cyanophenyl)-5-[2-(1-ethanimidoylpiperidin-4-yl)ethoxy]benzoate (PubChem CID 139798605) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 3-(3-cyanophenyl)-5-[2-(1-ethanimidoylpiperidin-4-yl)ethoxy]benzoate.
| Compound Name | methyl 3-(3-cyanophenyl)-5-[2-(1-ethanimidoylpiperidin-4-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 139798605 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | methyl 3-(3-cyanophenyl)-5-[2-(1-ethanimidoylpiperidin-4-yl)ethoxy]benzoate |
| SMILES | [H]/N=C(\C)N1CCC(CCOc2cc(C(=O)OC)cc(-c3cccc(C#N)c3)c2)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-17(26)27-9-6-18(7-10-27)8-11-30-23-14-21(13-22(15-23)24(28)29-2)20-5-3-4-19(12-20)16-25/h3-5,12-15,18,26H,6-11H2,1-2H3/b26-17+ |
| InChIKey | BGYKUZRVOZXOSF-YZSQISJMSA-N |
| XLogP | 4.49 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|