C24H26N4O3 — CID 139798650
methyl 3-(3-cyanophenyl)-5-[[2-(1-ethanimidoylpiperidin-4-yl)acetyl]amino]benzoate (PubChem CID 139798650) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 3-(3-cyanophenyl)-5-[[2-(1-ethanimidoylpiperidin-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 3-(3-cyanophenyl)-5-[[2-(1-ethanimidoylpiperidin-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 139798650 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl 3-(3-cyanophenyl)-5-[[2-(1-ethanimidoylpiperidin-4-yl)acetyl]amino]benzoate |
| SMILES | [H]/N=C(\C)N1CCC(CC(=O)Nc2cc(C(=O)OC)cc(-c3cccc(C#N)c3)c2)CC1 |
| InChI | InChI=1S/C24H26N4O3/c1-16(26)28-8-6-17(7-9-28)11-23(29)27-22-13-20(12-21(14-22)24(30)31-2)19-5-3-4-18(10-19)15-25/h3-5,10,12-14,17,26H,6-9,11H2,1-2H3,(H,27,29)/b26-16+ |
| InChIKey | CHAIDSINVDNYKL-WGOQTCKBSA-N |
| XLogP | 4.05 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|