C31H38Cl2N6O4 — CID 146158164
2-[3-(3-carbamimidoylphenyl)-2-[[[2-[4-(1-ethanimidoylpiperidin-4-yl)anilino]-2-oxoethyl]amino]methyl]phenoxy]acetic acid;dihydrochloride (PubChem CID 146158164) has the molecular formula C31H38Cl2N6O4 and a molecular weight of 629.59 g/mol. Its IUPAC name is 2-[3-(3-carbamimidoylphenyl)-2-[[[2-[4-(1-ethanimidoylpiperidin-4-yl)anilino]-2-oxoethyl]amino]methyl]phenoxy]acetic acid;dihydrochloride.
| Compound Name | 2-[3-(3-carbamimidoylphenyl)-2-[[[2-[4-(1-ethanimidoylpiperidin-4-yl)anilino]-2-oxoethyl]amino]methyl]phenoxy]acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 146158164 |
| Molecular Formula | C31H38Cl2N6O4 |
| Molecular Weight | 629.59 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 2-[3-(3-carbamimidoylphenyl)-2-[[[2-[4-(1-ethanimidoylpiperidin-4-yl)anilino]-2-oxoethyl]amino]methyl]phenoxy]acetic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1cccc(-c2cccc(OCC(=O)O)c2CNCC(=O)Nc2ccc(C3CCN(/C(C)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C31H36N6O4.2ClH/c1-20(32)37-14-12-22(13-15-37)21-8-10-25(11-9-21)36-29(38)18-35-17-27-26(6-3-7-28(27)41-19-30(39)40)23-4-2-5-24(16-23)31(33)34;;/h2-11,16,22,32,35H,12-15,17-19H2,1H3,(H3,33,34)(H,36,38)(H,39,40);2*1H/b32-20+;; |
| InChIKey | GDIHPUYKMYKOKV-FHRFEZIFSA-N |
| XLogP | 4.85 |
| TPSA | 164.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|