C22H27N3O4 — CID 57039348
(2R)-2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(oxan-4-yloxy)phenyl]acetic acid (PubChem CID 57039348) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (2R)-2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(oxan-4-yloxy)phenyl]acetic acid.
| Compound Name | (2R)-2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(oxan-4-yloxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 57039348 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (2R)-2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(oxan-4-yloxy)phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)O)c2cc(CC)ccc2OC2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-2-14-3-8-19(29-17-9-11-28-12-10-17)18(13-14)20(22(26)27)25-16-6-4-15(5-7-16)21(23)24/h3-8,13,17,20,25H,2,9-12H2,1H3,(H3,23,24)(H,26,27)/t20-/m1/s1 |
| InChIKey | HIEPMBTULUYMIE-HXUWFJFHSA-N |
| XLogP | 3.33 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|