C24H30N4O5 — CID 22038814
2-(4-carbamimidoylanilino)-2-[3-[1-(carboxymethyl)piperidin-4-yl]oxy-5-ethylphenyl]acetic acid (PubChem CID 22038814) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-[1-(carboxymethyl)piperidin-4-yl]oxy-5-ethylphenyl]acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-[1-(carboxymethyl)piperidin-4-yl]oxy-5-ethylphenyl]acetic acid |
|---|---|
| PubChem CID | 22038814 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-[1-(carboxymethyl)piperidin-4-yl]oxy-5-ethylphenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(CC)cc(OC3CCN(CC(=O)O)CC3)c2)cc1 |
| InChI | InChI=1S/C24H30N4O5/c1-2-15-11-17(22(24(31)32)27-18-5-3-16(4-6-18)23(25)26)13-20(12-15)33-19-7-9-28(10-8-19)14-21(29)30/h3-6,11-13,19,22,27H,2,7-10,14H2,1H3,(H3,25,26)(H,29,30)(H,31,32) |
| InChIKey | WINKTPYUDYLGNF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 148.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|