C24H26N4O6S — CID 22039146
2-(4-carbamimidoylanilino)-2-[2-(methanesulfonamido)-5-methoxy-4-phenylmethoxyphenyl]acetic acid (PubChem CID 22039146) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[2-(methanesulfonamido)-5-methoxy-4-phenylmethoxyphenyl]acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[2-(methanesulfonamido)-5-methoxy-4-phenylmethoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 22039146 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[2-(methanesulfonamido)-5-methoxy-4-phenylmethoxyphenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(OC)c(OCc3ccccc3)cc2NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H26N4O6S/c1-33-20-12-18(22(24(29)30)27-17-10-8-16(9-11-17)23(25)26)19(28-35(2,31)32)13-21(20)34-14-15-6-4-3-5-7-15/h3-13,22,27-28H,14H2,1-2H3,(H3,25,26)(H,29,30) |
| InChIKey | ADPNZSTYZFYPDQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 163.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|