C23H35N5O6S2 — CID 69471662
4-[[1-[4,5-diethoxy-2-(methanesulfonamido)phenyl]-2-(propylsulfonylamino)ethyl]amino]benzenecarboximidamide (PubChem CID 69471662) has the molecular formula C23H35N5O6S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 4-[[1-[4,5-diethoxy-2-(methanesulfonamido)phenyl]-2-(propylsulfonylamino)ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-[4,5-diethoxy-2-(methanesulfonamido)phenyl]-2-(propylsulfonylamino)ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 69471662 |
| Molecular Formula | C23H35N5O6S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 4-[[1-[4,5-diethoxy-2-(methanesulfonamido)phenyl]-2-(propylsulfonylamino)ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(CNS(=O)(=O)CCC)c2cc(OCC)c(OCC)cc2NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H35N5O6S2/c1-5-12-36(31,32)26-15-20(27-17-10-8-16(9-11-17)23(24)25)18-13-21(33-6-2)22(34-7-3)14-19(18)28-35(4,29)30/h8-11,13-14,20,26-28H,5-7,12,15H2,1-4H3,(H3,24,25) |
| InChIKey | WMCKLFRQRHHBJF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 172.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|