C25H31N3O8 — CID 87905109
acetyl 2-(4-carbamimidoylanilino)-2-[4,5-diethoxy-2-(1-ethoxy-2-oxoethoxy)phenyl]acetate (PubChem CID 87905109) has the molecular formula C25H31N3O8 and a molecular weight of 501.54 g/mol. Its IUPAC name is acetyl 2-(4-carbamimidoylanilino)-2-[4,5-diethoxy-2-(1-ethoxy-2-oxoethoxy)phenyl]acetate.
| Compound Name | acetyl 2-(4-carbamimidoylanilino)-2-[4,5-diethoxy-2-(1-ethoxy-2-oxoethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 87905109 |
| Molecular Formula | C25H31N3O8 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | acetyl 2-(4-carbamimidoylanilino)-2-[4,5-diethoxy-2-(1-ethoxy-2-oxoethoxy)phenyl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)OC(C)=O)c2cc(OCC)c(OCC)cc2OC(C=O)OCC)cc1 |
| InChI | InChI=1S/C25H31N3O8/c1-5-32-20-12-18(19(13-21(20)33-6-2)36-22(14-29)34-7-3)23(25(31)35-15(4)30)28-17-10-8-16(9-11-17)24(26)27/h8-14,22-23,28H,5-7H2,1-4H3,(H3,26,27) |
| InChIKey | XUFZBTKNPWGLKH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|