C20H23N3O6 — CID 87905147
acetyl 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-4-methoxyphenyl]acetate (PubChem CID 87905147) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is acetyl 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-4-methoxyphenyl]acetate.
| Compound Name | acetyl 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 87905147 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | acetyl 2-(4-carbamimidoylanilino)-2-[2-(2-hydroxyethoxy)-4-methoxyphenyl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)OC(C)=O)c2ccc(OC)cc2OCCO)cc1 |
| InChI | InChI=1S/C20H23N3O6/c1-12(25)29-20(26)18(23-14-5-3-13(4-6-14)19(21)22)16-8-7-15(27-2)11-17(16)28-10-9-24/h3-8,11,18,23-24H,9-10H2,1-2H3,(H3,21,22) |
| InChIKey | NLLXELRAKAWSJN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|