C26H31N5O4 — CID 59495477
4-[[1-(4,5-dimethoxy-2-propoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide (PubChem CID 59495477) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-[[1-(4,5-dimethoxy-2-propoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(4,5-dimethoxy-2-propoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495477 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-[[1-(4,5-dimethoxy-2-propoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNc2ccccc2)c2cc(OC)c(OC)cc2OCCC)cc1 |
| InChI | InChI=1S/C26H31N5O4/c1-4-14-35-21-16-23(34-3)22(33-2)15-20(21)24(26(32)31-30-19-8-6-5-7-9-19)29-18-12-10-17(11-13-18)25(27)28/h5-13,15-16,24,29-30H,4,14H2,1-3H3,(H3,27,28)(H,31,32) |
| InChIKey | MKTPKYHFDINWQE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|