C24H24BrN5O2 — CID 59495421
4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide (PubChem CID 59495421) has the molecular formula C24H24BrN5O2 and a molecular weight of 494.39 g/mol. Its IUPAC name is 4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495421 |
| Molecular Formula | C24H24BrN5O2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNc2ccccc2)c2ccc(OCC=C)c(Br)c2)cc1 |
| InChI | InChI=1S/C24H24BrN5O2/c1-2-14-32-21-13-10-17(15-20(21)25)22(24(31)30-29-19-6-4-3-5-7-19)28-18-11-8-16(9-12-18)23(26)27/h2-13,15,22,28-29H,1,14H2,(H3,26,27)(H,30,31) |
| InChIKey | NADXNFZLZBMBTJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|