C28H29N5O5 — CID 59495456
2-[2-[2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetyl]hydrazinyl]benzoic acid (PubChem CID 59495456) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[2-[2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetyl]hydrazinyl]benzoic acid.
| Compound Name | 2-[2-[2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetyl]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 59495456 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-[2-[2-[3,4-bis(prop-2-enoxy)phenyl]-2-(4-carbamimidoylanilino)acetyl]hydrazinyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNc2ccccc2C(=O)O)c2ccc(OCC=C)c(OCC=C)c2)cc1 |
| InChI | InChI=1S/C28H29N5O5/c1-3-15-37-23-14-11-19(17-24(23)38-16-4-2)25(31-20-12-9-18(10-13-20)26(29)30)27(34)33-32-22-8-6-5-7-21(22)28(35)36/h3-14,17,25,31-32H,1-2,15-16H2,(H3,29,30)(H,33,34)(H,35,36) |
| InChIKey | XMNPLFRAIBDKIA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|