C30H32F3N5O6 — CID 87530908
(2,2,2-trifluoroacetyl) 2-[2-[2-(4-carbamimidoylanilino)-2-[3,4-di(propan-2-yloxy)phenyl]acetyl]hydrazinyl]benzoate (PubChem CID 87530908) has the molecular formula C30H32F3N5O6 and a molecular weight of 615.61 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-[2-[2-(4-carbamimidoylanilino)-2-[3,4-di(propan-2-yloxy)phenyl]acetyl]hydrazinyl]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-[2-[2-(4-carbamimidoylanilino)-2-[3,4-di(propan-2-yloxy)phenyl]acetyl]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 87530908 |
| Molecular Formula | C30H32F3N5O6 |
| Molecular Weight | 615.61 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-[2-[2-(4-carbamimidoylanilino)-2-[3,4-di(propan-2-yloxy)phenyl]acetyl]hydrazinyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNc2ccccc2C(=O)OC(=O)C(F)(F)F)c2ccc(OC(C)C)c(OC(C)C)c2)cc1 |
| InChI | InChI=1S/C30H32F3N5O6/c1-16(2)42-23-14-11-19(15-24(23)43-17(3)4)25(36-20-12-9-18(10-13-20)26(34)35)27(39)38-37-22-8-6-5-7-21(22)28(40)44-29(41)30(31,32)33/h5-17,25,36-37H,1-4H3,(H3,34,35)(H,38,39) |
| InChIKey | RBJXNIOMDTWDBA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|