C26H28N6O3 — CID 59495280
4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-oxo-2-(2-pyridin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide (PubChem CID 59495280) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-oxo-2-(2-pyridin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-oxo-2-(2-pyridin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495280 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-oxo-2-(2-pyridin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNc2ccccn2)c2ccc(OCC=C)c(OCC=C)c2)cc1 |
| InChI | InChI=1S/C26H28N6O3/c1-3-15-34-21-13-10-19(17-22(21)35-16-4-2)24(26(33)32-31-23-7-5-6-14-29-23)30-20-11-8-18(9-12-20)25(27)28/h3-14,17,24,30H,1-2,15-16H2,(H3,27,28)(H,29,31)(H,32,33) |
| InChIKey | MXQIBRFFFMMFJB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|