C27H27ClN6O4 — CID 59495486
4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495486) has the molecular formula C27H27ClN6O4 and a molecular weight of 535.00 g/mol. Its IUPAC name is 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495486 |
| Molecular Formula | C27H27ClN6O4 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 4-[[1-[3,4-bis(prop-2-enoxy)phenyl]-2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2cnccc2Cl)c2ccc(OCC=C)c(OCC=C)c2)cc1 |
| InChI | InChI=1S/C27H27ClN6O4/c1-3-13-37-22-10-7-18(15-23(22)38-14-4-2)24(32-19-8-5-17(6-9-19)25(29)30)27(36)34-33-26(35)20-16-31-12-11-21(20)28/h3-12,15-16,24,32H,1-2,13-14H2,(H3,29,30)(H,33,35)(H,34,36) |
| InChIKey | HEHONDYXDSKMHA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|