C25H26ClFN6O4 — CID 59495445
4-[[2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-1-(2-fluoro-5-methoxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 59495445) has the molecular formula C25H26ClFN6O4 and a molecular weight of 528.97 g/mol. Its IUPAC name is 4-[[2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-1-(2-fluoro-5-methoxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-1-(2-fluoro-5-methoxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 59495445 |
| Molecular Formula | C25H26ClFN6O4 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 4-[[2-[2-(4-chloropyridine-3-carbonyl)hydrazinyl]-1-(2-fluoro-5-methoxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2cnccc2Cl)c2cc(OC)cc(OCCC)c2F)cc1 |
| InChI | InChI=1S/C25H26ClFN6O4/c1-3-10-37-20-12-16(36-2)11-17(21(20)27)22(31-15-6-4-14(5-7-15)23(28)29)25(35)33-32-24(34)18-13-30-9-8-19(18)26/h4-9,11-13,22,31H,3,10H2,1-2H3,(H3,28,29)(H,32,34)(H,33,35) |
| InChIKey | NGISPFMBWQHXLE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|