C24H24ClFN6O4 — CID 143213010
4-[[2-[2-(3-chloropyridine-4-carbonyl)hydrazinyl]-1-(2-fluoro-5-hydroxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 143213010) has the molecular formula C24H24ClFN6O4 and a molecular weight of 514.95 g/mol. Its IUPAC name is 4-[[2-[2-(3-chloropyridine-4-carbonyl)hydrazinyl]-1-(2-fluoro-5-hydroxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-[2-(3-chloropyridine-4-carbonyl)hydrazinyl]-1-(2-fluoro-5-hydroxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 143213010 |
| Molecular Formula | C24H24ClFN6O4 |
| Molecular Weight | 514.95 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 4-[[2-[2-(3-chloropyridine-4-carbonyl)hydrazinyl]-1-(2-fluoro-5-hydroxy-3-propoxyphenyl)-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccncc2Cl)c2cc(O)cc(OCCC)c2F)cc1 |
| InChI | InChI=1S/C24H24ClFN6O4/c1-2-9-36-19-11-15(33)10-17(20(19)26)21(30-14-5-3-13(4-6-14)22(27)28)24(35)32-31-23(34)16-7-8-29-12-18(16)25/h3-8,10-12,21,30,33H,2,9H2,1H3,(H3,27,28)(H,31,34)(H,32,35) |
| InChIKey | DMHNQVJTZOAPOD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|