C31H39N7O5 — CID 143213103
2-[4-[1-(4-carbamimidoylanilino)-2-[2-(3-methylpyridine-4-carbonyl)hydrazinyl]prop-2-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide;ethenol (PubChem CID 143213103) has the molecular formula C31H39N7O5 and a molecular weight of 589.70 g/mol. Its IUPAC name is 2-[4-[1-(4-carbamimidoylanilino)-2-[2-(3-methylpyridine-4-carbonyl)hydrazinyl]prop-2-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide;ethenol.
| Compound Name | 2-[4-[1-(4-carbamimidoylanilino)-2-[2-(3-methylpyridine-4-carbonyl)hydrazinyl]prop-2-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide;ethenol |
|---|---|
| PubChem CID | 143213103 |
| Molecular Formula | C31H39N7O5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 2-[4-[1-(4-carbamimidoylanilino)-2-[2-(3-methylpyridine-4-carbonyl)hydrazinyl]prop-2-enyl]-2-ethoxyphenoxy]-N,N-dimethylacetamide;ethenol |
| SMILES | C=CO.[H]/N=C(\N)c1ccc(NC(C(=C)NNC(=O)c2ccncc2C)c2ccc(OCC(=O)N(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C29H35N7O4.C2H4O/c1-6-39-25-15-21(9-12-24(25)40-17-26(37)36(4)5)27(33-22-10-7-20(8-11-22)28(30)31)19(3)34-35-29(38)23-13-14-32-16-18(23)2;1-2-3/h7-16,27,33-34H,3,6,17H2,1-2,4-5H3,(H3,30,31)(H,35,38);2-3H,1H2 |
| InChIKey | WWIGKOOJTIIJIN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 174.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|