C26H25BrF3N5O4 — CID 68652676
4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68652676) has the molecular formula C26H25BrF3N5O4 and a molecular weight of 608.42 g/mol. Its IUPAC name is 4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68652676 |
| Molecular Formula | C26H25BrF3N5O4 |
| Molecular Weight | 608.42 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | 4-[[1-(3-bromo-4-prop-2-enoxyphenyl)-2-oxo-2-(2-phenylhydrazinyl)ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNc2ccccc2)c2ccc(OCC=C)c(Br)c2)cc1 |
| InChI | InChI=1S/C24H24BrN5O2.C2HF3O2/c1-2-14-32-21-13-10-17(15-20(21)25)22(24(31)30-29-19-6-4-3-5-7-19)28-18-11-8-16(9-12-18)23(26)27;3-2(4,5)1(6)7/h2-13,15,22,28-29H,1,14H2,(H3,26,27)(H,30,31);(H,6,7) |
| InChIKey | AOIOAHHAOLMOPF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|