C25H23N3O7 — CID 87905130
2-[4-(4-acetyloxycarbonylphenoxy)-3-methoxyphenyl]-2-(4-carbamimidoylanilino)acetic acid (PubChem CID 87905130) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-[4-(4-acetyloxycarbonylphenoxy)-3-methoxyphenyl]-2-(4-carbamimidoylanilino)acetic acid.
| Compound Name | 2-[4-(4-acetyloxycarbonylphenoxy)-3-methoxyphenyl]-2-(4-carbamimidoylanilino)acetic acid |
|---|---|
| PubChem CID | 87905130 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[4-(4-acetyloxycarbonylphenoxy)-3-methoxyphenyl]-2-(4-carbamimidoylanilino)acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2ccc(Oc3ccc(C(=O)OC(C)=O)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H23N3O7/c1-14(29)34-25(32)16-5-10-19(11-6-16)35-20-12-7-17(13-21(20)33-2)22(24(30)31)28-18-8-3-15(4-9-18)23(26)27/h3-13,22,28H,1-2H3,(H3,26,27)(H,30,31) |
| InChIKey | CNZHBFFPTAGJAA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|