C27H33FN8O5 — CID 143547847
acetic acid;N-[(Z)-C-[(4-carbamimidoylanilino)-[3-ethoxy-4-(2-fluoroethoxy)phenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide (PubChem CID 143547847) has the molecular formula C27H33FN8O5 and a molecular weight of 568.61 g/mol. Its IUPAC name is acetic acid;N-[(Z)-C-[(4-carbamimidoylanilino)-[3-ethoxy-4-(2-fluoroethoxy)phenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide.
| Compound Name | acetic acid;N-[(Z)-C-[(4-carbamimidoylanilino)-[3-ethoxy-4-(2-fluoroethoxy)phenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide |
|---|---|
| PubChem CID | 143547847 |
| Molecular Formula | C27H33FN8O5 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | acetic acid;N-[(Z)-C-[(4-carbamimidoylanilino)-[3-ethoxy-4-(2-fluoroethoxy)phenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(NC(/C(=N/N(C)c2ncccn2)NC=O)c2ccc(OCCF)c(OCC)c2)cc1 |
| InChI | InChI=1S/C25H29FN8O3.C2H4O2/c1-3-36-21-15-18(7-10-20(21)37-14-11-26)22(32-19-8-5-17(6-9-19)23(27)28)24(31-16-35)33-34(2)25-29-12-4-13-30-25;1-2(3)4/h4-10,12-13,15-16,22,32H,3,11,14H2,1-2H3,(H3,27,28)(H,31,33,35);1H3,(H,3,4) |
| InChIKey | YUYZLIPXRJTCQK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|