C24H27FN8O3 — CID 143547961
N-[(Z)-C-[(4-carbamimidoylanilino)-[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide (PubChem CID 143547961) has the molecular formula C24H27FN8O3 and a molecular weight of 494.53 g/mol. Its IUPAC name is N-[(Z)-C-[(4-carbamimidoylanilino)-[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide.
| Compound Name | N-[(Z)-C-[(4-carbamimidoylanilino)-[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide |
|---|---|
| PubChem CID | 143547961 |
| Molecular Formula | C24H27FN8O3 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[(Z)-C-[(4-carbamimidoylanilino)-[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-N-[methyl(pyrimidin-2-yl)amino]carbonimidoyl]formamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(/C(=N/N(C)c2ncccn2)NC=O)c2ccc(OCCF)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H27FN8O3/c1-33(24-28-11-3-12-29-24)32-23(30-15-34)21(31-18-7-4-16(5-8-18)22(26)27)17-6-9-19(36-13-10-25)20(14-17)35-2/h3-9,11-12,14-15,21,31H,10,13H2,1-2H3,(H3,26,27)(H,30,32,34) |
| InChIKey | BCSAWIXGYYLCIU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|