C22H24FN9O3 — CID 143547874
4-[[(2Z)-1-[3-(2-fluoroethoxy)-5-methoxyphenyl]-2-(oxohydrazinylidene)-2-(2-pyrimidin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide (PubChem CID 143547874) has the molecular formula C22H24FN9O3 and a molecular weight of 481.49 g/mol. Its IUPAC name is 4-[[(2Z)-1-[3-(2-fluoroethoxy)-5-methoxyphenyl]-2-(oxohydrazinylidene)-2-(2-pyrimidin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[(2Z)-1-[3-(2-fluoroethoxy)-5-methoxyphenyl]-2-(oxohydrazinylidene)-2-(2-pyrimidin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 143547874 |
| Molecular Formula | C22H24FN9O3 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 4-[[(2Z)-1-[3-(2-fluoroethoxy)-5-methoxyphenyl]-2-(oxohydrazinylidene)-2-(2-pyrimidin-2-ylhydrazinyl)ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(/C(=N/N=O)NNc2ncccn2)c2cc(OC)cc(OCCF)c2)cc1 |
| InChI | InChI=1S/C22H24FN9O3/c1-34-17-11-15(12-18(13-17)35-10-7-23)19(28-16-5-3-14(4-6-16)20(24)25)21(30-32-33)29-31-22-26-8-2-9-27-22/h2-6,8-9,11-13,19,28H,7,10H2,1H3,(H3,24,25)(H,26,27,31)(H,29,30,33) |
| InChIKey | ZBDXFHNAMSHOCA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 171.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|