C28H37N7O4 — CID 89346427
4-[[2-[2-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienoyl]hydrazinyl]-1-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-2-oxoethyl]amino]benzenecarboximidamide (PubChem CID 89346427) has the molecular formula C28H37N7O4 and a molecular weight of 535.65 g/mol. Its IUPAC name is 4-[[2-[2-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienoyl]hydrazinyl]-1-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-2-oxoethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-[2-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienoyl]hydrazinyl]-1-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-2-oxoethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 89346427 |
| Molecular Formula | C28H37N7O4 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 4-[[2-[2-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienoyl]hydrazinyl]-1-[4-[2-(dimethylamino)ethoxy]-3-ethoxyphenyl]-2-oxoethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)C(/C=C\N)=C/C=C)c2ccc(OCCN(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C28H37N7O4/c1-5-7-20(14-15-29)27(36)33-34-28(37)25(32-22-11-8-19(9-12-22)26(30)31)21-10-13-23(24(18-21)38-6-2)39-17-16-35(3)4/h5,7-15,18,25,32H,1,6,16-17,29H2,2-4H3,(H3,30,31)(H,33,36)(H,34,37)/b15-14-,20-7+ |
| InChIKey | ZFSMTAFENPLOBX-NFMBNXISSA-N |
| XLogP | 2.20 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|