C30H32N3O5P — CID 25019447
[(4-carbamimidoylanilino)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]-phenylmethoxyphosphinic acid (PubChem CID 25019447) has the molecular formula C30H32N3O5P and a molecular weight of 545.58 g/mol. Its IUPAC name is [(4-carbamimidoylanilino)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]-phenylmethoxyphosphinic acid.
| Compound Name | [(4-carbamimidoylanilino)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 25019447 |
| Molecular Formula | C30H32N3O5P |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | [(4-carbamimidoylanilino)-(3-ethoxy-4-phenylmethoxyphenyl)methyl]-phenylmethoxyphosphinic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2ccc(OCc3ccccc3)c(OCC)c2)P(=O)(O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N3O5P/c1-2-36-28-19-25(15-18-27(28)37-20-22-9-5-3-6-10-22)30(33-26-16-13-24(14-17-26)29(31)32)39(34,35)38-21-23-11-7-4-8-12-23/h3-19,30,33H,2,20-21H2,1H3,(H3,31,32)(H,34,35) |
| InChIKey | IMJWWGVMEIHFLK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|