C32H36N4O4S — CID 54263971
4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]ethyl]amino]benzenecarboximidamide (PubChem CID 54263971) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is 4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 54263971 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(CNS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H36N4O4S/c1-22(2)24-11-16-28(17-12-24)41(37,38)35-20-29(36-27-14-9-25(10-15-27)32(33)34)26-13-18-30(31(19-26)39-3)40-21-23-7-5-4-6-8-23/h4-19,22,29,35-36H,20-21H2,1-3H3,(H3,33,34) |
| InChIKey | RFLKXXLZEAIUFS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|