C27H28N4O4S2 — CID 54374394
4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylsulfonylamino)ethyl]amino]benzenecarboximidamide (PubChem CID 54374394) has the molecular formula C27H28N4O4S2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylsulfonylamino)ethyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylsulfonylamino)ethyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 54374394 |
| Molecular Formula | C27H28N4O4S2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 4-[[1-(3-methoxy-4-phenylmethoxyphenyl)-2-(thiophen-2-ylsulfonylamino)ethyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(CNS(=O)(=O)c2cccs2)c2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H28N4O4S2/c1-34-25-16-21(11-14-24(25)35-18-19-6-3-2-4-7-19)23(17-30-37(32,33)26-8-5-15-36-26)31-22-12-9-20(10-13-22)27(28)29/h2-16,23,30-31H,17-18H2,1H3,(H3,28,29) |
| InChIKey | UVLMADBISGFZSP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|