C26H35N5O5S — CID 11272528
(2R)-N-butylsulfonyl-2-(4-carbamimidoylanilino)-2-[2-[(dimethylamino)methyl]-7-ethoxy-1-benzofuran-5-yl]acetamide (PubChem CID 11272528) has the molecular formula C26H35N5O5S and a molecular weight of 529.66 g/mol. Its IUPAC name is (2R)-N-butylsulfonyl-2-(4-carbamimidoylanilino)-2-[2-[(dimethylamino)methyl]-7-ethoxy-1-benzofuran-5-yl]acetamide.
| Compound Name | (2R)-N-butylsulfonyl-2-(4-carbamimidoylanilino)-2-[2-[(dimethylamino)methyl]-7-ethoxy-1-benzofuran-5-yl]acetamide |
|---|---|
| PubChem CID | 11272528 |
| Molecular Formula | C26H35N5O5S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (2R)-N-butylsulfonyl-2-(4-carbamimidoylanilino)-2-[2-[(dimethylamino)methyl]-7-ethoxy-1-benzofuran-5-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)NS(=O)(=O)CCCC)c2cc(OCC)c3oc(CN(C)C)cc3c2)cc1 |
| InChI | InChI=1S/C26H35N5O5S/c1-5-7-12-37(33,34)30-26(32)23(29-20-10-8-17(9-11-20)25(27)28)18-13-19-14-21(16-31(3)4)36-24(19)22(15-18)35-6-2/h8-11,13-15,23,29H,5-7,12,16H2,1-4H3,(H3,27,28)(H,30,32)/t23-/m1/s1 |
| InChIKey | RNVLXJWSHCERCC-HSZRJFAPSA-N |
| XLogP | 3.58 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|