C18H22ClN3O4S — CID 142650046
ethyl 2-(4-carbamimidoylanilino)-2-(3-methylsulfonylphenyl)acetate;hydrochloride (PubChem CID 142650046) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is ethyl 2-(4-carbamimidoylanilino)-2-(3-methylsulfonylphenyl)acetate;hydrochloride.
| Compound Name | ethyl 2-(4-carbamimidoylanilino)-2-(3-methylsulfonylphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 142650046 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 2-(4-carbamimidoylanilino)-2-(3-methylsulfonylphenyl)acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)OCC)c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H21N3O4S.ClH/c1-3-25-18(22)16(13-5-4-6-15(11-13)26(2,23)24)21-14-9-7-12(8-10-14)17(19)20;/h4-11,16,21H,3H2,1-2H3,(H3,19,20);1H |
| InChIKey | NRXSDIUQYHGHJX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|