C24H26N4O3 — CID 54027250
2-[3-(3-aminophenyl)-5-ethoxyphenyl]-2-(4-carbamimidoylanilino)propanoic acid (PubChem CID 54027250) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[3-(3-aminophenyl)-5-ethoxyphenyl]-2-(4-carbamimidoylanilino)propanoic acid.
| Compound Name | 2-[3-(3-aminophenyl)-5-ethoxyphenyl]-2-(4-carbamimidoylanilino)propanoic acid |
|---|---|
| PubChem CID | 54027250 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[3-(3-aminophenyl)-5-ethoxyphenyl]-2-(4-carbamimidoylanilino)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C)(C(=O)O)c2cc(OCC)cc(-c3cccc(N)c3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-3-31-21-13-17(16-5-4-6-19(25)12-16)11-18(14-21)24(2,23(29)30)28-20-9-7-15(8-10-20)22(26)27/h4-14,28H,3,25H2,1-2H3,(H3,26,27)(H,29,30) |
| InChIKey | LDBIMPOTAPVUJC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|