C22H28N4O4 — CID 57299372
(2R)-2-(4-carbamimidoylanilino)-N-(cyclopropylmethyl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 57299372) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2R)-2-(4-carbamimidoylanilino)-N-(cyclopropylmethyl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | (2R)-2-(4-carbamimidoylanilino)-N-(cyclopropylmethyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 57299372 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2R)-2-(4-carbamimidoylanilino)-N-(cyclopropylmethyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)NCC2CC2)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-28-17-10-15(11-18(29-2)20(17)30-3)19(22(27)25-12-13-4-5-13)26-16-8-6-14(7-9-16)21(23)24/h6-11,13,19,26H,4-5,12H2,1-3H3,(H3,23,24)(H,25,27)/t19-/m1/s1 |
| InChIKey | PCIFAKXQPXQEBI-LJQANCHMSA-N |
| XLogP | 2.68 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|