C28H41N5O3 — CID 167844937
methyl 6-[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-4-phenylbutan-2-yl]amino]hexanoate (PubChem CID 167844937) has the molecular formula C28H41N5O3 and a molecular weight of 495.67 g/mol. Its IUPAC name is methyl 6-[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-4-phenylbutan-2-yl]amino]hexanoate.
| Compound Name | methyl 6-[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-4-phenylbutan-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 167844937 |
| Molecular Formula | C28H41N5O3 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | methyl 6-[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-4-phenylbutan-2-yl]amino]hexanoate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC[C@@H](CCc2ccccc2)NCCCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C28H41N5O3/c1-21(28(35)33-19-23-12-15-24(16-13-23)27(29)30)32-20-25(17-14-22-9-5-3-6-10-22)31-18-8-4-7-11-26(34)36-2/h3,5-6,9-10,12-13,15-16,21,25,31-32H,4,7-8,11,14,17-20H2,1-2H3,(H3,29,30)(H,33,35)/t21-,25+/m0/s1 |
| InChIKey | UUNDVHHZSOKXMI-SQJMNOBHSA-N |
| XLogP | 2.89 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|